Logo
Published on

Ultimate Guide to Trigonometric Integration and t-formulas

Authors
  • avatar
    Name
    Vu Hung
    Twitter

Introduction

In HSC Mathematics Advanced and Extension 1, you learned how to integrate basic trigonometric functions and squares like sin2x\sin^2 x and cos2x\cos^2 x. In HSC Mathematics Extension 2, the complexity ramps up. How do you integrate a product of two different trigonometric functions with different periods, like sin(3x)cos(5x)\sin(3x)\cos(5x)? Furthermore, how do you handle fractions containing trigonometric terms in the denominator? This guide covers the essential identities that turn impossible trigonometric integrals into simple sums, and introduces the universal substitution known as the tt-formulas.

Executive Summary

This guide breaks down two core trigonometric techniques:

  • Products to Sums: Deriving and applying the identities that convert products like sin(A)cos(B)\sin(A)\cos(B) into sums like 12[sin(A+B)+sin(AB)]\frac{1}{2}[\sin(A+B) + \sin(A-B)] to make integration possible.
  • The tt-formulas: Defining t=tan(x2)t = \tan(\frac{x}{2}) to express sinx\sin x, cosx\cos x, and tanx\tan x entirely in terms of the algebraic variable tt.
  • Solving Equations: Using tt-formulas to solve trigonometric equations over restricted domains.

What is this about?

Integration is a linear operator. This means it is very easy to integrate a sum of functions (you just integrate each piece separately), but it is generally very difficult to integrate a product of functions. When faced with sin(3x)cos(5x)dx\int \sin(3x)\cos(5x) \, dx, you cannot just integrate the sine and the cosine separately.

To solve this, we use Products to Sums identities to rewrite the product as a sum of two separate trigonometric terms, which can then be integrated easily.

Additionally, equations like 3sinx+4cosx=53\sin x + 4\cos x = 5 can be solved using auxiliary angles (from Ext 1), but the tt-formulas provide a purely algebraic alternative. By substituting t=tan(x2)t = \tan(\frac{x}{2}), every trigonometric term is converted into a polynomial or rational fraction in tt, turning a trigonometry problem into a standard algebra problem.

Main Content

1. Products to Sums Identities

The syllabus requires you to be able to derive these formulas from the standard compound angle formulas learned in Extension 1.

Derivation Example: We know the compound angle formulas for sine:

  1. sin(A+B)=sinAcosB+cosAsinB\sin(A + B) = \sin A \cos B + \cos A \sin B
  2. sin(AB)=sinAcosBcosAsinB\sin(A - B) = \sin A \cos B - \cos A \sin B

If we add equation (1) and equation (2) together, the cosAsinB\cos A \sin B terms cancel out: sin(A+B)+sin(AB)=2sinAcosB\sin(A + B) + \sin(A - B) = 2\sin A \cos B

Rearranging this gives us our first product-to-sum identity: sinAcosB=12[sin(A+B)+sin(AB)]\sin A \cos B = \frac{1}{2} [\sin(A+B) + \sin(A-B)]

By adding or subtracting the compound angle formulas for cosine, we can derive the other two essential identities: cosAcosB=12[cos(A+B)+cos(AB)]\cos A \cos B = \frac{1}{2} [\cos(A+B) + \cos(A-B)] sinAsinB=12[cos(AB)cos(A+B)]\sin A \sin B = \frac{1}{2} [\cos(A-B) - \cos(A+B)] (Note the order in the last one! It is ABA-B minus A+BA+B to avoid negative signs).

2. Integrating Trigonometric Products

Once you have converted the product into a sum, integration is straightforward.

Example: Evaluate sin(3x)cos(2x)dx\int \sin(3x) \cos(2x) \, dx. Here, A=3xA = 3x and B=2xB = 2x. sin(3x)cos(2x)=12[sin(3x+2x)+sin(3x2x)]\sin(3x) \cos(2x) = \frac{1}{2} [\sin(3x+2x) + \sin(3x-2x)] =12[sin(5x)+sin(x)]= \frac{1}{2} [\sin(5x) + \sin(x)]

Now, integrate the sum: 12[sin(5x)+sin(x)]dx\int \frac{1}{2} [\sin(5x) + \sin(x)] \, dx =12[15cos(5x)cos(x)]+C= \frac{1}{2} \left[ -\frac{1}{5}\cos(5x) - \cos(x) \right] + C =110cos(5x)12cos(x)+C= -\frac{1}{10}\cos(5x) - \frac{1}{2}\cos(x) + C

3. The tt-formulas

The tt-formulas are based on the substitution t=tan(x2)t = \tan\left(\frac{x}{2}\right). Using double angle formulas and right-angled triangle geometry, we can derive expressions for sinx\sin x, cosx\cos x, and tanx\tan x entirely in terms of tt:

sinx=2t1+t2\sin x = \frac{2t}{1 + t^2} cosx=1t21+t2\cos x = \frac{1 - t^2}{1 + t^2} tanx=2t1t2\tan x = \frac{2t}{1 - t^2}

Syllabus Note: You must be able to derive these. Start with sinx=sin(2×x2)=2sin(x2)cos(x2)\sin x = \sin(2 \times \frac{x}{2}) = 2\sin(\frac{x}{2})\cos(\frac{x}{2}), then divide by cos2(x2)+sin2(x2)\cos^2(\frac{x}{2}) + \sin^2(\frac{x}{2}) (which equals 1), and divide top and bottom by cos2(x2)\cos^2(\frac{x}{2}) to introduce tan(x2)\tan(\frac{x}{2}).

4. Solving Equations with tt-formulas

When solving an equation like asinx+bcosx=ca\sin x + b\cos x = c, you can substitute the tt-formulas to create a rational algebraic equation.

Warning: The Domain Restriction When you use the substitution t=tan(x2)t = \tan(\frac{x}{2}), you are assuming that tan(x2)\tan(\frac{x}{2}) is defined. However, the tangent function has asymptotes. tan(x2)\tan(\frac{x}{2}) is undefined when x2=π2\frac{x}{2} = \frac{\pi}{2} (i.e., when x=π,3π,πx = \pi, 3\pi, -\pi, etc.). If you use the tt-formulas, you must manually check if x=πx = \pi is a valid solution to the original equation, because the tt-formula method will completely "miss" this solution.

Simple Worked Example

Question: Solve the equation 3cosx4sinx=33\cos x - 4\sin x = 3 for 0x2π0 \le x \le 2\pi using the tt-formulas.

Solution: Step 1: Substitute the tt-formulas. Let t=tan(x2)t = \tan\left(\frac{x}{2}\right). Substitute cosx=1t21+t2\cos x = \frac{1-t^2}{1+t^2} and sinx=2t1+t2\sin x = \frac{2t}{1+t^2} into the equation: 3(1t21+t2)4(2t1+t2)=33\left(\frac{1-t^2}{1+t^2}\right) - 4\left(\frac{2t}{1+t^2}\right) = 3

Step 2: Solve the algebraic equation. Multiply the entire equation by (1+t2)(1+t^2) to clear denominators: 3(1t2)4(2t)=3(1+t2)3(1-t^2) - 4(2t) = 3(1+t^2) 33t28t=3+3t23 - 3t^2 - 8t = 3 + 3t^2 Move all terms to one side: 0=6t2+8t0 = 6t^2 + 8t 0=2t(3t+4)0 = 2t(3t + 4)

So, t=0t = 0 or t=43t = -\frac{4}{3}.

Step 3: Convert tt back to xx. Recall that t=tan(x2)t = \tan\left(\frac{x}{2}\right). If t=0t = 0: tan(x2)=0\tan\left(\frac{x}{2}\right) = 0 x2=0,π,2π\frac{x}{2} = 0, \pi, 2\pi x=0,2π,4πx = 0, 2\pi, 4\pi Within the domain 0x2π0 \le x \le 2\pi, the solutions are x=0x = 0 and x=2πx = 2\pi.

If t=43t = -\frac{4}{3}: tan(x2)=43\tan\left(\frac{x}{2}\right) = -\frac{4}{3} Since tangent is negative, x2\frac{x}{2} is in the 2nd quadrant. x2=πtan1(43)2.214\frac{x}{2} = \pi - \tan^{-1}\left(\frac{4}{3}\right) \approx 2.214 x=2×2.2144.43x = 2 \times 2.214 \approx 4.43 radians.

Step 4: Check the undefined case. Is x=πx = \pi a solution? LHS = 3cos(π)4sin(π)=3(1)4(0)=33\cos(\pi) - 4\sin(\pi) = 3(-1) - 4(0) = -3. RHS = 33. Since 33-3 \neq 3, x=πx = \pi is not a solution.

Final Answer: x=0,2πx = 0, 2\pi, and x4.43x \approx 4.43.

mini-FAQ page

Q: Should I use auxiliary angles (Rcos(xα)R\cos(x-\alpha)) or tt-formulas to solve asinx+bcosx=ca\sin x + b\cos x = c? A: Both are valid. The auxiliary angle method is usually faster and less prone to algebraic errors, and it doesn't require checking the x=πx=\pi case. However, if the question specifically says "using the tt-formulas," you must use this algebraic approach to get the marks.

Q: Do I need to memorize the product-to-sum formulas? A: They are usually provided on the HSC Reference Sheet, but the syllabus requires you to be able to derive them. Understanding the derivation makes them much easier to remember and use under exam pressure.

Common mistakes to avoid

  • Forgetting the 12\frac{1}{2} in product-to-sums: A very common mistake is writing sinAcosB=sin(A+B)+sin(AB)\sin A \cos B = \sin(A+B) + \sin(A-B). You must remember the factor of 12\frac{1}{2} out the front.
  • Forgetting to manually check x=πx=\pi: If you use tt-formulas and the true solution includes x=πx=\pi, the algebra will simply not yield it. You will lose marks if you do not show that you manually tested the boundary condition.

Practice on Vu's Maths Hub

Trigonometric integration requires a sharp memory for identities.

Further Readings

Connect with me

Want to master Integration and guarantee top marks in HSC Mathematics Extension 2? Visit Vu's Maths Hub for in-depth booklets, rigorous worked solutions, and expert advice to help you ace your exams!